C12H8ClF3N2O3S — CID 70291084
6-[2-chloro-4-(trifluoromethyl)phenoxy]pyridine-3-sulfonamide (PubChem CID 70291084) has the molecular formula C12H8ClF3N2O3S and a molecular weight of 352.72 g/mol. Its IUPAC name is 6-[2-chloro-4-(trifluoromethyl)phenoxy]pyridine-3-sulfonamide.
| Compound Name | 6-[2-chloro-4-(trifluoromethyl)phenoxy]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 70291084 |
| Molecular Formula | C12H8ClF3N2O3S |
| Molecular Weight | 352.72 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | 6-[2-chloro-4-(trifluoromethyl)phenoxy]pyridine-3-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc(Oc2ccc(C(F)(F)F)cc2Cl)nc1 |
| InChI | InChI=1S/C12H8ClF3N2O3S/c13-9-5-7(12(14,15)16)1-3-10(9)21-11-4-2-8(6-18-11)22(17,19)20/h1-6H,(H2,17,19,20) |
| InChIKey | BESODARTBFWKND-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.72 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |