C12H9F3N2O3S — CID 99771190
4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]benzenesulfonamide (PubChem CID 99771190) has the molecular formula C12H9F3N2O3S and a molecular weight of 318.28 g/mol. Its IUPAC name is 4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]benzenesulfonamide.
| Compound Name | 4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]benzenesulfonamide |
|---|---|
| PubChem CID | 99771190 |
| Molecular Formula | C12H9F3N2O3S |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(Oc2ccc(C(F)(F)F)cn2)cc1 |
| InChI | InChI=1S/C12H9F3N2O3S/c13-12(14,15)8-1-6-11(17-7-8)20-9-2-4-10(5-3-9)21(16,18)19/h1-7H,(H2,16,18,19) |
| InChIKey | UWMKWABVZPQPLO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |