C11H8F2N2O3S — CID 112572688
6-(3,4-difluorophenoxy)pyridine-3-sulfonamide (PubChem CID 112572688) has the molecular formula C11H8F2N2O3S and a molecular weight of 286.26 g/mol. Its IUPAC name is 6-(3,4-difluorophenoxy)pyridine-3-sulfonamide.
| Compound Name | 6-(3,4-difluorophenoxy)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 112572688 |
| Molecular Formula | C11H8F2N2O3S |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 6-(3,4-difluorophenoxy)pyridine-3-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc(Oc2ccc(F)c(F)c2)nc1 |
| InChI | InChI=1S/C11H8F2N2O3S/c12-9-3-1-7(5-10(9)13)18-11-4-2-8(6-15-11)19(14,16)17/h1-6H,(H2,14,16,17) |
| InChIKey | HWMJGKIHOKIBPI-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |