C9H13F3N4O2S — CID 107494274
6-[2-aminoethyl(2,2,2-trifluoroethyl)amino]pyridine-3-sulfonamide (PubChem CID 107494274) has the molecular formula C9H13F3N4O2S and a molecular weight of 298.29 g/mol. Its IUPAC name is 6-[2-aminoethyl(2,2,2-trifluoroethyl)amino]pyridine-3-sulfonamide.
| Compound Name | 6-[2-aminoethyl(2,2,2-trifluoroethyl)amino]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 107494274 |
| Molecular Formula | C9H13F3N4O2S |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 6-[2-aminoethyl(2,2,2-trifluoroethyl)amino]pyridine-3-sulfonamide |
| SMILES | NCCN(CC(F)(F)F)c1ccc(S(N)(=O)=O)cn1 |
| InChI | InChI=1S/C9H13F3N4O2S/c10-9(11,12)6-16(4-3-13)8-2-1-7(5-15-8)19(14,17)18/h1-2,5H,3-4,6,13H2,(H2,14,17,18) |
| InChIKey | XQUBJOSHWMXIQL-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |