C11H13F3N2O — CID 80638350
6-[propyl(2,2,2-trifluoroethyl)amino]pyridine-3-carbaldehyde (PubChem CID 80638350) has the molecular formula C11H13F3N2O and a molecular weight of 246.23 g/mol. Its IUPAC name is 6-[propyl(2,2,2-trifluoroethyl)amino]pyridine-3-carbaldehyde.
| Compound Name | 6-[propyl(2,2,2-trifluoroethyl)amino]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 80638350 |
| Molecular Formula | C11H13F3N2O |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 6-[propyl(2,2,2-trifluoroethyl)amino]pyridine-3-carbaldehyde |
| SMILES | CCCN(CC(F)(F)F)c1ccc(C=O)cn1 |
| InChI | InChI=1S/C11H13F3N2O/c1-2-5-16(8-11(12,13)14)10-4-3-9(7-17)6-15-10/h3-4,6-7H,2,5,8H2,1H3 |
| InChIKey | SVWFGMNHHCQTOA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|