C16H28N2O5S2 — CID 119989827
N-(2-amino-2-ethylbutyl)-4-(2-ethylsulfonylethoxy)benzenesulfonamide (PubChem CID 119989827) has the molecular formula C16H28N2O5S2 and a molecular weight of 392.54 g/mol. Its IUPAC name is N-(2-amino-2-ethylbutyl)-4-(2-ethylsulfonylethoxy)benzenesulfonamide.
| Compound Name | N-(2-amino-2-ethylbutyl)-4-(2-ethylsulfonylethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 119989827 |
| Molecular Formula | C16H28N2O5S2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | N-(2-amino-2-ethylbutyl)-4-(2-ethylsulfonylethoxy)benzenesulfonamide |
| SMILES | CCC(N)(CC)CNS(=O)(=O)c1ccc(OCCS(=O)(=O)CC)cc1 |
| InChI | InChI=1S/C16H28N2O5S2/c1-4-16(17,5-2)13-18-25(21,22)15-9-7-14(8-10-15)23-11-12-24(19,20)6-3/h7-10,18H,4-6,11-13,17H2,1-3H3 |
| InChIKey | WQLHGAQQMSAUOX-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |