C13H23ClN2O5S2 — CID 119962062
N-(3-aminopropyl)-4-(2-ethylsulfonylethoxy)benzenesulfonamide;hydrochloride (PubChem CID 119962062) has the molecular formula C13H23ClN2O5S2 and a molecular weight of 386.92 g/mol. Its IUPAC name is N-(3-aminopropyl)-4-(2-ethylsulfonylethoxy)benzenesulfonamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-4-(2-ethylsulfonylethoxy)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119962062 |
| Molecular Formula | C13H23ClN2O5S2 |
| Molecular Weight | 386.92 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | N-(3-aminopropyl)-4-(2-ethylsulfonylethoxy)benzenesulfonamide;hydrochloride |
| SMILES | CCS(=O)(=O)CCOc1ccc(S(=O)(=O)NCCCN)cc1.Cl |
| InChI | InChI=1S/C13H22N2O5S2.ClH/c1-2-21(16,17)11-10-20-12-4-6-13(7-5-12)22(18,19)15-9-3-8-14;/h4-7,15H,2-3,8-11,14H2,1H3;1H |
| InChIKey | MGIRGCMUIXKWND-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.92 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|