C12H20N2O3S2 — CID 106066211
4-(2-aminoethoxy)-N-(3-methylsulfanylpropyl)benzenesulfonamide (PubChem CID 106066211) has the molecular formula C12H20N2O3S2 and a molecular weight of 304.44 g/mol. Its IUPAC name is 4-(2-aminoethoxy)-N-(3-methylsulfanylpropyl)benzenesulfonamide.
| Compound Name | 4-(2-aminoethoxy)-N-(3-methylsulfanylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106066211 |
| Molecular Formula | C12H20N2O3S2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 4-(2-aminoethoxy)-N-(3-methylsulfanylpropyl)benzenesulfonamide |
| SMILES | CSCCCNS(=O)(=O)c1ccc(OCCN)cc1 |
| InChI | InChI=1S/C12H20N2O3S2/c1-18-10-2-8-14-19(15,16)12-5-3-11(4-6-12)17-9-7-13/h3-6,14H,2,7-10,13H2,1H3 |
| InChIKey | SINQALCYBLKOHW-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|