C12H17F3N2O3S — CID 75476540
N-(2-hydroxy-3-methylpentyl)-6-(trifluoromethyl)pyridine-3-sulfonamide (PubChem CID 75476540) has the molecular formula C12H17F3N2O3S and a molecular weight of 326.34 g/mol. Its IUPAC name is N-(2-hydroxy-3-methylpentyl)-6-(trifluoromethyl)pyridine-3-sulfonamide.
| Compound Name | N-(2-hydroxy-3-methylpentyl)-6-(trifluoromethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 75476540 |
| Molecular Formula | C12H17F3N2O3S |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | N-(2-hydroxy-3-methylpentyl)-6-(trifluoromethyl)pyridine-3-sulfonamide |
| SMILES | CCC(C)C(O)CNS(=O)(=O)c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C12H17F3N2O3S/c1-3-8(2)10(18)7-17-21(19,20)9-4-5-11(16-6-9)12(13,14)15/h4-6,8,10,17-18H,3,7H2,1-2H3 |
| InChIKey | BWYOOKXQVRTMRE-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |