C12H20BrClN2O2S — CID 119990005
N-(2-amino-2-ethylbutyl)-3-bromobenzenesulfonamide;hydrochloride (PubChem CID 119990005) has the molecular formula C12H20BrClN2O2S and a molecular weight of 371.73 g/mol. Its IUPAC name is N-(2-amino-2-ethylbutyl)-3-bromobenzenesulfonamide;hydrochloride.
| Compound Name | N-(2-amino-2-ethylbutyl)-3-bromobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119990005 |
| Molecular Formula | C12H20BrClN2O2S |
| Molecular Weight | 371.73 g/mol |
| Exact Mass | 370.01 |
| IUPAC Name | N-(2-amino-2-ethylbutyl)-3-bromobenzenesulfonamide;hydrochloride |
| SMILES | CCC(N)(CC)CNS(=O)(=O)c1cccc(Br)c1.Cl |
| InChI | InChI=1S/C12H19BrN2O2S.ClH/c1-3-12(14,4-2)9-15-18(16,17)11-7-5-6-10(13)8-11;/h5-8,15H,3-4,9,14H2,1-2H3;1H |
| InChIKey | VZSCNFGXUKQZMH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.73 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |