C14H26ClN3O4S2 — CID 119990180
N-[2-[(2-amino-2-ethylbutyl)sulfamoyl]ethyl]benzenesulfonamide;hydrochloride (PubChem CID 119990180) has the molecular formula C14H26ClN3O4S2 and a molecular weight of 399.97 g/mol. Its IUPAC name is N-[2-[(2-amino-2-ethylbutyl)sulfamoyl]ethyl]benzenesulfonamide;hydrochloride.
| Compound Name | N-[2-[(2-amino-2-ethylbutyl)sulfamoyl]ethyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119990180 |
| Molecular Formula | C14H26ClN3O4S2 |
| Molecular Weight | 399.97 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | N-[2-[(2-amino-2-ethylbutyl)sulfamoyl]ethyl]benzenesulfonamide;hydrochloride |
| SMILES | CCC(N)(CC)CNS(=O)(=O)CCNS(=O)(=O)c1ccccc1.Cl |
| InChI | InChI=1S/C14H25N3O4S2.ClH/c1-3-14(15,4-2)12-17-22(18,19)11-10-16-23(20,21)13-8-6-5-7-9-13;/h5-9,16-17H,3-4,10-12,15H2,1-2H3;1H |
| InChIKey | HFRDCAFEOURPLX-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.97 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |