C12H21N3O4S2 — CID 119975856
N-[2-[(1-amino-2-methylpropan-2-yl)sulfamoyl]ethyl]benzenesulfonamide (PubChem CID 119975856) has the molecular formula C12H21N3O4S2 and a molecular weight of 335.45 g/mol. Its IUPAC name is N-[2-[(1-amino-2-methylpropan-2-yl)sulfamoyl]ethyl]benzenesulfonamide.
| Compound Name | N-[2-[(1-amino-2-methylpropan-2-yl)sulfamoyl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 119975856 |
| Molecular Formula | C12H21N3O4S2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | N-[2-[(1-amino-2-methylpropan-2-yl)sulfamoyl]ethyl]benzenesulfonamide |
| SMILES | CC(C)(CN)NS(=O)(=O)CCNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H21N3O4S2/c1-12(2,10-13)15-20(16,17)9-8-14-21(18,19)11-6-4-3-5-7-11/h3-7,14-15H,8-10,13H2,1-2H3 |
| InChIKey | ZOPIJFNKQJDTJJ-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |