C9H22N2O2S — CID 63834751
N-(1-amino-2-methylpropan-2-yl)-3-methylbutane-1-sulfonamide (PubChem CID 63834751) has the molecular formula C9H22N2O2S and a molecular weight of 222.35 g/mol. Its IUPAC name is N-(1-amino-2-methylpropan-2-yl)-3-methylbutane-1-sulfonamide.
| Compound Name | N-(1-amino-2-methylpropan-2-yl)-3-methylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 63834751 |
| Molecular Formula | C9H22N2O2S |
| Molecular Weight | 222.35 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | N-(1-amino-2-methylpropan-2-yl)-3-methylbutane-1-sulfonamide |
| SMILES | CC(C)CCS(=O)(=O)NC(C)(C)CN |
| InChI | InChI=1S/C9H22N2O2S/c1-8(2)5-6-14(12,13)11-9(3,4)7-10/h8,11H,5-7,10H2,1-4H3 |
| InChIKey | PHPZCEXKNARHTL-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.35 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |