C12H26BrNO2S — CID 107158135
N-(2-bromo-4,4-dimethylpentyl)-3-methylbutane-1-sulfonamide (PubChem CID 107158135) has the molecular formula C12H26BrNO2S and a molecular weight of 328.32 g/mol. Its IUPAC name is N-(2-bromo-4,4-dimethylpentyl)-3-methylbutane-1-sulfonamide.
| Compound Name | N-(2-bromo-4,4-dimethylpentyl)-3-methylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 107158135 |
| Molecular Formula | C12H26BrNO2S |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | N-(2-bromo-4,4-dimethylpentyl)-3-methylbutane-1-sulfonamide |
| SMILES | CC(C)CCS(=O)(=O)NCC(Br)CC(C)(C)C |
| InChI | InChI=1S/C12H26BrNO2S/c1-10(2)6-7-17(15,16)14-9-11(13)8-12(3,4)5/h10-11,14H,6-9H2,1-5H3 |
| InChIKey | OZMACUBYABLLFT-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|