C16H26BrNO2S — CID 107158108
N-(2-bromo-4,4-dimethylpentyl)-2-phenylpropane-1-sulfonamide (PubChem CID 107158108) has the molecular formula C16H26BrNO2S and a molecular weight of 376.36 g/mol. Its IUPAC name is N-(2-bromo-4,4-dimethylpentyl)-2-phenylpropane-1-sulfonamide.
| Compound Name | N-(2-bromo-4,4-dimethylpentyl)-2-phenylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 107158108 |
| Molecular Formula | C16H26BrNO2S |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | N-(2-bromo-4,4-dimethylpentyl)-2-phenylpropane-1-sulfonamide |
| SMILES | CC(CS(=O)(=O)NCC(Br)CC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C16H26BrNO2S/c1-13(14-8-6-5-7-9-14)12-21(19,20)18-11-15(17)10-16(2,3)4/h5-9,13,15,18H,10-12H2,1-4H3 |
| InChIKey | YXAAURKIVUXZLG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|