C15H24BrNO2S — CID 106145736
N-(4-bromo-2,2-dimethylbutyl)-2-phenylpropane-1-sulfonamide (PubChem CID 106145736) has the molecular formula C15H24BrNO2S and a molecular weight of 362.33 g/mol. Its IUPAC name is N-(4-bromo-2,2-dimethylbutyl)-2-phenylpropane-1-sulfonamide.
| Compound Name | N-(4-bromo-2,2-dimethylbutyl)-2-phenylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 106145736 |
| Molecular Formula | C15H24BrNO2S |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | N-(4-bromo-2,2-dimethylbutyl)-2-phenylpropane-1-sulfonamide |
| SMILES | CC(CS(=O)(=O)NCC(C)(C)CCBr)c1ccccc1 |
| InChI | InChI=1S/C15H24BrNO2S/c1-13(14-7-5-4-6-8-14)11-20(18,19)17-12-15(2,3)9-10-16/h4-8,13,17H,9-12H2,1-3H3 |
| InChIKey | GEUXZYHYIBKCLS-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|