C9H21NO4S — CID 63856064
N-(2,2-dimethoxyethyl)-3-methylbutane-1-sulfonamide (PubChem CID 63856064) has the molecular formula C9H21NO4S and a molecular weight of 239.34 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-3-methylbutane-1-sulfonamide.
| Compound Name | N-(2,2-dimethoxyethyl)-3-methylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 63856064 |
| Molecular Formula | C9H21NO4S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-3-methylbutane-1-sulfonamide |
| SMILES | COC(CNS(=O)(=O)CCC(C)C)OC |
| InChI | InChI=1S/C9H21NO4S/c1-8(2)5-6-15(11,12)10-7-9(13-3)14-4/h8-10H,5-7H2,1-4H3 |
| InChIKey | GBEDZXUDPZQYGR-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|