C10H19ClN2O2S2 — CID 120874886
N-(1-amino-2-methylpropan-2-yl)-2-thiophen-2-ylethanesulfonamide;hydrochloride (PubChem CID 120874886) has the molecular formula C10H19ClN2O2S2 and a molecular weight of 298.86 g/mol. Its IUPAC name is N-(1-amino-2-methylpropan-2-yl)-2-thiophen-2-ylethanesulfonamide;hydrochloride.
| Compound Name | N-(1-amino-2-methylpropan-2-yl)-2-thiophen-2-ylethanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120874886 |
| Molecular Formula | C10H19ClN2O2S2 |
| Molecular Weight | 298.86 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | N-(1-amino-2-methylpropan-2-yl)-2-thiophen-2-ylethanesulfonamide;hydrochloride |
| SMILES | CC(C)(CN)NS(=O)(=O)CCc1cccs1.Cl |
| InChI | InChI=1S/C10H18N2O2S2.ClH/c1-10(2,8-11)12-16(13,14)7-5-9-4-3-6-15-9;/h3-4,6,12H,5,7-8,11H2,1-2H3;1H |
| InChIKey | NPMFPTCKDOKBAL-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.86 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |