C8H15ClN2O2S2 — CID 120874392
N-(2-aminoethyl)-2-thiophen-2-ylethanesulfonamide;hydrochloride (PubChem CID 120874392) has the molecular formula C8H15ClN2O2S2 and a molecular weight of 270.81 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-thiophen-2-ylethanesulfonamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-2-thiophen-2-ylethanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120874392 |
| Molecular Formula | C8H15ClN2O2S2 |
| Molecular Weight | 270.81 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | N-(2-aminoethyl)-2-thiophen-2-ylethanesulfonamide;hydrochloride |
| SMILES | Cl.NCCNS(=O)(=O)CCc1cccs1 |
| InChI | InChI=1S/C8H14N2O2S2.ClH/c9-4-5-10-14(11,12)7-3-8-2-1-6-13-8;/h1-2,6,10H,3-5,7,9H2;1H |
| InChIKey | LEYSTDQTLVCCQC-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.81 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |