C11H18N2O2S2 — CID 120874425
N-piperidin-4-yl-2-thiophen-2-ylethanesulfonamide (PubChem CID 120874425) has the molecular formula C11H18N2O2S2 and a molecular weight of 274.41 g/mol. Its IUPAC name is N-piperidin-4-yl-2-thiophen-2-ylethanesulfonamide.
| Compound Name | N-piperidin-4-yl-2-thiophen-2-ylethanesulfonamide |
|---|---|
| PubChem CID | 120874425 |
| Molecular Formula | C11H18N2O2S2 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | N-piperidin-4-yl-2-thiophen-2-ylethanesulfonamide |
| SMILES | O=S(=O)(CCc1cccs1)NC1CCNCC1 |
| InChI | InChI=1S/C11H18N2O2S2/c14-17(15,9-5-11-2-1-8-16-11)13-10-3-6-12-7-4-10/h1-2,8,10,12-13H,3-7,9H2 |
| InChIKey | RPLCDTGKIDOAJE-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |