C12H21ClN2O2S2 — CID 120876612
N-(2-methylpiperidin-3-yl)-2-thiophen-2-ylethanesulfonamide;hydrochloride (PubChem CID 120876612) has the molecular formula C12H21ClN2O2S2 and a molecular weight of 324.90 g/mol. Its IUPAC name is N-(2-methylpiperidin-3-yl)-2-thiophen-2-ylethanesulfonamide;hydrochloride.
| Compound Name | N-(2-methylpiperidin-3-yl)-2-thiophen-2-ylethanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120876612 |
| Molecular Formula | C12H21ClN2O2S2 |
| Molecular Weight | 324.90 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | N-(2-methylpiperidin-3-yl)-2-thiophen-2-ylethanesulfonamide;hydrochloride |
| SMILES | CC1NCCCC1NS(=O)(=O)CCc1cccs1.Cl |
| InChI | InChI=1S/C12H20N2O2S2.ClH/c1-10-12(5-2-7-13-10)14-18(15,16)9-6-11-4-3-8-17-11;/h3-4,8,10,12-14H,2,5-7,9H2,1H3;1H |
| InChIKey | MMRSVOJVNFSYRW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.90 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |