C13H19Cl2FN2O2S — CID 120876608
1-(3-chloro-4-fluorophenyl)-N-(2-methylpiperidin-3-yl)methanesulfonamide;hydrochloride (PubChem CID 120876608) has the molecular formula C13H19Cl2FN2O2S and a molecular weight of 357.28 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-N-(2-methylpiperidin-3-yl)methanesulfonamide;hydrochloride.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-N-(2-methylpiperidin-3-yl)methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120876608 |
| Molecular Formula | C13H19Cl2FN2O2S |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-N-(2-methylpiperidin-3-yl)methanesulfonamide;hydrochloride |
| SMILES | CC1NCCCC1NS(=O)(=O)Cc1ccc(F)c(Cl)c1.Cl |
| InChI | InChI=1S/C13H18ClFN2O2S.ClH/c1-9-13(3-2-6-16-9)17-20(18,19)8-10-4-5-12(15)11(14)7-10;/h4-5,7,9,13,16-17H,2-3,6,8H2,1H3;1H |
| InChIKey | XVSVCQDMIBWTQT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |