C14H24N2O3S2 — CID 120877176
N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-2-thiophen-2-ylethanesulfonamide (PubChem CID 120877176) has the molecular formula C14H24N2O3S2 and a molecular weight of 332.49 g/mol. Its IUPAC name is N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-2-thiophen-2-ylethanesulfonamide.
| Compound Name | N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-2-thiophen-2-ylethanesulfonamide |
|---|---|
| PubChem CID | 120877176 |
| Molecular Formula | C14H24N2O3S2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-2-thiophen-2-ylethanesulfonamide |
| SMILES | COCC1(CNS(=O)(=O)CCc2cccs2)CCNCC1 |
| InChI | InChI=1S/C14H24N2O3S2/c1-19-12-14(5-7-15-8-6-14)11-16-21(17,18)10-4-13-3-2-9-20-13/h2-3,9,15-16H,4-8,10-12H2,1H3 |
| InChIKey | YOWNLRHGOGFNMI-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |