C11H24N2O4S — CID 120896587
2-methoxy-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]ethanesulfonamide (PubChem CID 120896587) has the molecular formula C11H24N2O4S and a molecular weight of 280.39 g/mol. Its IUPAC name is 2-methoxy-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]ethanesulfonamide.
| Compound Name | 2-methoxy-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]ethanesulfonamide |
|---|---|
| PubChem CID | 120896587 |
| Molecular Formula | C11H24N2O4S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 2-methoxy-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]ethanesulfonamide |
| SMILES | COCCS(=O)(=O)NCC1(COC)CCNCC1 |
| InChI | InChI=1S/C11H24N2O4S/c1-16-7-8-18(14,15)13-9-11(10-17-2)3-5-12-6-4-11/h12-13H,3-10H2,1-2H3 |
| InChIKey | DJIUAVRODUPBIK-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |