C12H27N3O5S2 — CID 120896619
2-(ethylsulfonylamino)-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]ethanesulfonamide (PubChem CID 120896619) has the molecular formula C12H27N3O5S2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 2-(ethylsulfonylamino)-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]ethanesulfonamide.
| Compound Name | 2-(ethylsulfonylamino)-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]ethanesulfonamide |
|---|---|
| PubChem CID | 120896619 |
| Molecular Formula | C12H27N3O5S2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 2-(ethylsulfonylamino)-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCCS(=O)(=O)NCC1(COC)CCNCC1 |
| InChI | InChI=1S/C12H27N3O5S2/c1-3-21(16,17)14-8-9-22(18,19)15-10-12(11-20-2)4-6-13-7-5-12/h13-15H,3-11H2,1-2H3 |
| InChIKey | FXLITBKOWDDCPB-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |