C14H32ClN3O5S — CID 120896370
4-[[bis(2-methoxyethyl)sulfamoylamino]methyl]-4-(methoxymethyl)piperidine;hydrochloride (PubChem CID 120896370) has the molecular formula C14H32ClN3O5S and a molecular weight of 389.95 g/mol. Its IUPAC name is 4-[[bis(2-methoxyethyl)sulfamoylamino]methyl]-4-(methoxymethyl)piperidine;hydrochloride.
| Compound Name | 4-[[bis(2-methoxyethyl)sulfamoylamino]methyl]-4-(methoxymethyl)piperidine;hydrochloride |
|---|---|
| PubChem CID | 120896370 |
| Molecular Formula | C14H32ClN3O5S |
| Molecular Weight | 389.95 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 4-[[bis(2-methoxyethyl)sulfamoylamino]methyl]-4-(methoxymethyl)piperidine;hydrochloride |
| SMILES | COCCN(CCOC)S(=O)(=O)NCC1(COC)CCNCC1.Cl |
| InChI | InChI=1S/C14H31N3O5S.ClH/c1-20-10-8-17(9-11-21-2)23(18,19)16-12-14(13-22-3)4-6-15-7-5-14;/h15-16H,4-13H2,1-3H3;1H |
| InChIKey | RFYHRDJUFWEJJC-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.95 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |