C11H25ClN2O4S — CID 120896586
2-methoxy-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]ethanesulfonamide;hydrochloride (PubChem CID 120896586) has the molecular formula C11H25ClN2O4S and a molecular weight of 316.85 g/mol. Its IUPAC name is 2-methoxy-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]ethanesulfonamide;hydrochloride.
| Compound Name | 2-methoxy-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]ethanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120896586 |
| Molecular Formula | C11H25ClN2O4S |
| Molecular Weight | 316.85 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 2-methoxy-N-[[4-(methoxymethyl)piperidin-4-yl]methyl]ethanesulfonamide;hydrochloride |
| SMILES | COCCS(=O)(=O)NCC1(COC)CCNCC1.Cl |
| InChI | InChI=1S/C11H24N2O4S.ClH/c1-16-7-8-18(14,15)13-9-11(10-17-2)3-5-12-6-4-11;/h12-13H,3-10H2,1-2H3;1H |
| InChIKey | RZEKZSMQCJAQOK-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.85 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |