C11H19ClN2O2S2 — CID 120999403
1-(2-thiophen-2-ylethylsulfonyl)-1,4-diazepane;hydrochloride (PubChem CID 120999403) has the molecular formula C11H19ClN2O2S2 and a molecular weight of 310.87 g/mol. Its IUPAC name is 1-(2-thiophen-2-ylethylsulfonyl)-1,4-diazepane;hydrochloride.
| Compound Name | 1-(2-thiophen-2-ylethylsulfonyl)-1,4-diazepane;hydrochloride |
|---|---|
| PubChem CID | 120999403 |
| Molecular Formula | C11H19ClN2O2S2 |
| Molecular Weight | 310.87 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 1-(2-thiophen-2-ylethylsulfonyl)-1,4-diazepane;hydrochloride |
| SMILES | Cl.O=S(=O)(CCc1cccs1)N1CCCNCC1 |
| InChI | InChI=1S/C11H18N2O2S2.ClH/c14-17(15,10-4-11-3-1-9-16-11)13-7-2-5-12-6-8-13;/h1,3,9,12H,2,4-8,10H2;1H |
| InChIKey | BTWIMLUSPCBQRI-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.87 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |