C12H20N2O4S2 — CID 64629339
N-ethyl-4-(1-methylsulfonylpropan-2-ylamino)benzenesulfonamide (PubChem CID 64629339) has the molecular formula C12H20N2O4S2 and a molecular weight of 320.44 g/mol. Its IUPAC name is N-ethyl-4-(1-methylsulfonylpropan-2-ylamino)benzenesulfonamide.
| Compound Name | N-ethyl-4-(1-methylsulfonylpropan-2-ylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 64629339 |
| Molecular Formula | C12H20N2O4S2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | N-ethyl-4-(1-methylsulfonylpropan-2-ylamino)benzenesulfonamide |
| SMILES | CCNS(=O)(=O)c1ccc(NC(C)CS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C12H20N2O4S2/c1-4-13-20(17,18)12-7-5-11(6-8-12)14-10(2)9-19(3,15)16/h5-8,10,13-14H,4,9H2,1-3H3 |
| InChIKey | YRBOFXQXYZTRGU-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |