C23H23N3O3S3 — CID 70122550
3-(benzenesulfonamido)-N-benzylthiophene-2-carboxamide;thiophen-2-ylmethanamine (PubChem CID 70122550) has the molecular formula C23H23N3O3S3 and a molecular weight of 485.66 g/mol. Its IUPAC name is 3-(benzenesulfonamido)-N-benzylthiophene-2-carboxamide;thiophen-2-ylmethanamine.
| Compound Name | 3-(benzenesulfonamido)-N-benzylthiophene-2-carboxamide;thiophen-2-ylmethanamine |
|---|---|
| PubChem CID | 70122550 |
| Molecular Formula | C23H23N3O3S3 |
| Molecular Weight | 485.66 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | 3-(benzenesulfonamido)-N-benzylthiophene-2-carboxamide;thiophen-2-ylmethanamine |
| SMILES | NCc1cccs1.O=C(NCc1ccccc1)c1sccc1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H16N2O3S2.C5H7NS/c21-18(19-13-14-7-3-1-4-8-14)17-16(11-12-24-17)20-25(22,23)15-9-5-2-6-10-15;6-4-5-2-1-3-7-5/h1-12,20H,13H2,(H,19,21);1-3H,4,6H2 |
| InChIKey | HBVUCJUWGKEIQV-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.66 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |