C20H17N3O3S2 — CID 147308828
3-(benzenesulfonamido)-N-(thiophen-2-ylmethyl)-1H-isoindole-5-carboxamide (PubChem CID 147308828) has the molecular formula C20H17N3O3S2 and a molecular weight of 411.51 g/mol. Its IUPAC name is 3-(benzenesulfonamido)-N-(thiophen-2-ylmethyl)-1H-isoindole-5-carboxamide.
| Compound Name | 3-(benzenesulfonamido)-N-(thiophen-2-ylmethyl)-1H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 147308828 |
| Molecular Formula | C20H17N3O3S2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | 3-(benzenesulfonamido)-N-(thiophen-2-ylmethyl)-1H-isoindole-5-carboxamide |
| SMILES | O=C(NCc1cccs1)c1ccc2c(c1)C(NS(=O)(=O)c1ccccc1)=NC2 |
| InChI | InChI=1S/C20H17N3O3S2/c24-20(22-13-16-5-4-10-27-16)14-8-9-15-12-21-19(18(15)11-14)23-28(25,26)17-6-2-1-3-7-17/h1-11H,12-13H2,(H,21,23)(H,22,24) |
| InChIKey | CXNXHMAEYRPSFJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |