C25H24N4O3S — CID 152823581
3-[(3-morpholin-4-ylbenzoyl)amino]-N-(thiophen-2-ylmethyl)-1H-isoindole-5-carboxamide (PubChem CID 152823581) has the molecular formula C25H24N4O3S and a molecular weight of 460.56 g/mol. Its IUPAC name is 3-[(3-morpholin-4-ylbenzoyl)amino]-N-(thiophen-2-ylmethyl)-1H-isoindole-5-carboxamide.
| Compound Name | 3-[(3-morpholin-4-ylbenzoyl)amino]-N-(thiophen-2-ylmethyl)-1H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 152823581 |
| Molecular Formula | C25H24N4O3S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 3-[(3-morpholin-4-ylbenzoyl)amino]-N-(thiophen-2-ylmethyl)-1H-isoindole-5-carboxamide |
| SMILES | O=C(NCc1cccs1)c1ccc2c(c1)C(NC(=O)c1cccc(N3CCOCC3)c1)=NC2 |
| InChI | InChI=1S/C25H24N4O3S/c30-24(27-16-21-5-2-12-33-21)18-6-7-19-15-26-23(22(19)14-18)28-25(31)17-3-1-4-20(13-17)29-8-10-32-11-9-29/h1-7,12-14H,8-11,15-16H2,(H,27,30)(H,26,28,31) |
| InChIKey | SUJMXMVMJJJRHX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |