C29H31N5O2 — CID 158007086
4-(4-methylpiperazin-1-yl)-N-[6-(3-pyridin-2-ylbutanoyl)-3H-isoindol-1-yl]benzamide (PubChem CID 158007086) has the molecular formula C29H31N5O2 and a molecular weight of 481.60 g/mol. Its IUPAC name is 4-(4-methylpiperazin-1-yl)-N-[6-(3-pyridin-2-ylbutanoyl)-3H-isoindol-1-yl]benzamide.
| Compound Name | 4-(4-methylpiperazin-1-yl)-N-[6-(3-pyridin-2-ylbutanoyl)-3H-isoindol-1-yl]benzamide |
|---|---|
| PubChem CID | 158007086 |
| Molecular Formula | C29H31N5O2 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | 4-(4-methylpiperazin-1-yl)-N-[6-(3-pyridin-2-ylbutanoyl)-3H-isoindol-1-yl]benzamide |
| SMILES | CC(CC(=O)c1ccc2c(c1)C(NC(=O)c1ccc(N3CCN(C)CC3)cc1)=NC2)c1ccccn1 |
| InChI | InChI=1S/C29H31N5O2/c1-20(26-5-3-4-12-30-26)17-27(35)22-6-7-23-19-31-28(25(23)18-22)32-29(36)21-8-10-24(11-9-21)34-15-13-33(2)14-16-34/h3-12,18,20H,13-17,19H2,1-2H3,(H,31,32,36) |
| InChIKey | FEKQLUNENZLSGD-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 77.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |