C23H18N2O3S2 — CID 70122578
3-(benzenesulfonamido)-N-(3-phenylphenyl)thiophene-2-carboxamide (PubChem CID 70122578) has the molecular formula C23H18N2O3S2 and a molecular weight of 434.54 g/mol. Its IUPAC name is 3-(benzenesulfonamido)-N-(3-phenylphenyl)thiophene-2-carboxamide.
| Compound Name | 3-(benzenesulfonamido)-N-(3-phenylphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 70122578 |
| Molecular Formula | C23H18N2O3S2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | 3-(benzenesulfonamido)-N-(3-phenylphenyl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1cccc(-c2ccccc2)c1)c1sccc1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H18N2O3S2/c26-23(24-19-11-7-10-18(16-19)17-8-3-1-4-9-17)22-21(14-15-29-22)25-30(27,28)20-12-5-2-6-13-20/h1-16,25H,(H,24,26) |
| InChIKey | QKDWPYNWBDQCBK-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |