C12H14F3N3O3 — CID 133340888
N-methyl-2-(4-methyl-2-nitroanilino)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 133340888) has the molecular formula C12H14F3N3O3 and a molecular weight of 305.26 g/mol. Its IUPAC name is N-methyl-2-(4-methyl-2-nitroanilino)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | N-methyl-2-(4-methyl-2-nitroanilino)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 133340888 |
| Molecular Formula | C12H14F3N3O3 |
| Molecular Weight | 305.26 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | N-methyl-2-(4-methyl-2-nitroanilino)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | Cc1ccc(NCC(=O)N(C)CC(F)(F)F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H14F3N3O3/c1-8-3-4-9(10(5-8)18(20)21)16-6-11(19)17(2)7-12(13,14)15/h3-5,16H,6-7H2,1-2H3 |
| InChIKey | MLTYEPZDYHUJPK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.26 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|