C17H29N3O2 — CID 55925113
1-[2-(diethylamino)ethyl]-3-(4-methyl-2-propoxyphenyl)urea (PubChem CID 55925113) has the molecular formula C17H29N3O2 and a molecular weight of 307.44 g/mol. Its IUPAC name is 1-[2-(diethylamino)ethyl]-3-(4-methyl-2-propoxyphenyl)urea.
| Compound Name | 1-[2-(diethylamino)ethyl]-3-(4-methyl-2-propoxyphenyl)urea |
|---|---|
| PubChem CID | 55925113 |
| Molecular Formula | C17H29N3O2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | 1-[2-(diethylamino)ethyl]-3-(4-methyl-2-propoxyphenyl)urea |
| SMILES | CCCOc1cc(C)ccc1NC(=O)NCCN(CC)CC |
| InChI | InChI=1S/C17H29N3O2/c1-5-12-22-16-13-14(4)8-9-15(16)19-17(21)18-10-11-20(6-2)7-3/h8-9,13H,5-7,10-12H2,1-4H3,(H2,18,19,21) |
| InChIKey | OBGMIPWXONDWJU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |