C12H13NO2 — CID 115979782
(E)-3-(furan-2-yl)-N-pent-3-ynylprop-2-enamide (PubChem CID 115979782) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-N-pent-3-ynylprop-2-enamide.
| Compound Name | (E)-3-(furan-2-yl)-N-pent-3-ynylprop-2-enamide |
|---|---|
| PubChem CID | 115979782 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | (E)-3-(furan-2-yl)-N-pent-3-ynylprop-2-enamide |
| SMILES | CC#CCCNC(=O)/C=C/c1ccco1 |
| InChI | InChI=1S/C12H13NO2/c1-2-3-4-9-13-12(14)8-7-11-6-5-10-15-11/h5-8,10H,4,9H2,1H3,(H,13,14)/b8-7+ |
| InChIKey | CYFGRRDGGUDHKO-BQYQJAHWSA-N |
| XLogP | 1.82 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|