C19H22N2O4 — CID 3751982
N-[2-[2-(2-ethoxyphenyl)ethylamino]-2-oxoethyl]-3-(furan-2-yl)prop-2-enamide (PubChem CID 3751982) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-[2-[2-(2-ethoxyphenyl)ethylamino]-2-oxoethyl]-3-(furan-2-yl)prop-2-enamide.
| Compound Name | N-[2-[2-(2-ethoxyphenyl)ethylamino]-2-oxoethyl]-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 3751982 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | N-[2-[2-(2-ethoxyphenyl)ethylamino]-2-oxoethyl]-3-(furan-2-yl)prop-2-enamide |
| SMILES | CCOc1ccccc1CCNC(=O)CNC(=O)C=Cc1ccco1 |
| InChI | InChI=1S/C19H22N2O4/c1-2-24-17-8-4-3-6-15(17)11-12-20-19(23)14-21-18(22)10-9-16-7-5-13-25-16/h3-10,13H,2,11-12,14H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | VBTPOKVRKSGMFJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|