C17H26N4O5 — CID 111163298
ethyl 4-[N-[(4-methoxycarbonyl-5-methylfuran-2-yl)methyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate (PubChem CID 111163298) has the molecular formula C17H26N4O5 and a molecular weight of 366.42 g/mol. Its IUPAC name is ethyl 4-[N-[(4-methoxycarbonyl-5-methylfuran-2-yl)methyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[N-[(4-methoxycarbonyl-5-methylfuran-2-yl)methyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111163298 |
| Molecular Formula | C17H26N4O5 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | ethyl 4-[N-[(4-methoxycarbonyl-5-methylfuran-2-yl)methyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(/C(=N/C)NCc2cc(C(=O)OC)c(C)o2)CC1 |
| InChI | InChI=1S/C17H26N4O5/c1-5-25-17(23)21-8-6-20(7-9-21)16(18-3)19-11-13-10-14(12(2)26-13)15(22)24-4/h10H,5-9,11H2,1-4H3,(H,18,19) |
| InChIKey | DSIQZQUGMPVUOF-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|