C17H26N4O4 — CID 111928879
methyl 5-[[[N-ethyl-N'-(2-oxo-2-pyrrolidin-1-ylethyl)carbamimidoyl]amino]methyl]-2-methylfuran-3-carboxylate (PubChem CID 111928879) has the molecular formula C17H26N4O4 and a molecular weight of 350.42 g/mol. Its IUPAC name is methyl 5-[[[N-ethyl-N'-(2-oxo-2-pyrrolidin-1-ylethyl)carbamimidoyl]amino]methyl]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[[[N-ethyl-N'-(2-oxo-2-pyrrolidin-1-ylethyl)carbamimidoyl]amino]methyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 111928879 |
| Molecular Formula | C17H26N4O4 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | methyl 5-[[[N-ethyl-N'-(2-oxo-2-pyrrolidin-1-ylethyl)carbamimidoyl]amino]methyl]-2-methylfuran-3-carboxylate |
| SMILES | CCN/C(=N\CC(=O)N1CCCC1)NCc1cc(C(=O)OC)c(C)o1 |
| InChI | InChI=1S/C17H26N4O4/c1-4-18-17(20-11-15(22)21-7-5-6-8-21)19-10-13-9-14(12(2)25-13)16(23)24-3/h9H,4-8,10-11H2,1-3H3,(H2,18,19,20) |
| InChIKey | NNOVYOYQTIXILP-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|