C19H23F3IN3O3 — CID 111267460
methyl 5-[[[N-ethyl-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide (PubChem CID 111267460) has the molecular formula C19H23F3IN3O3 and a molecular weight of 525.31 g/mol. Its IUPAC name is methyl 5-[[[N-ethyl-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide.
| Compound Name | methyl 5-[[[N-ethyl-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111267460 |
| Molecular Formula | C19H23F3IN3O3 |
| Molecular Weight | 525.31 g/mol |
| Exact Mass | 525.07 |
| IUPAC Name | methyl 5-[[[N-ethyl-N'-[[3-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(C(F)(F)F)c1)NCc1cc(C(=O)OC)c(C)o1.I |
| InChI | InChI=1S/C19H22F3N3O3.HI/c1-4-23-18(24-10-13-6-5-7-14(8-13)19(20,21)22)25-11-15-9-16(12(2)28-15)17(26)27-3;/h5-9H,4,10-11H2,1-3H3,(H2,23,24,25);1H |
| InChIKey | HYGYRMPTJVUJGD-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.31 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|