C19H21F4N3O3 — CID 111889615
methyl 5-[[[N-ethyl-N'-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]methyl]-2-methylfuran-3-carboxylate (PubChem CID 111889615) has the molecular formula C19H21F4N3O3 and a molecular weight of 415.39 g/mol. Its IUPAC name is methyl 5-[[[N-ethyl-N'-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]methyl]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[[[N-ethyl-N'-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]methyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 111889615 |
| Molecular Formula | C19H21F4N3O3 |
| Molecular Weight | 415.39 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | methyl 5-[[[N-ethyl-N'-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]methyl]-2-methylfuran-3-carboxylate |
| SMILES | CCN/C(=N\Cc1ccc(F)cc1C(F)(F)F)NCc1cc(C(=O)OC)c(C)o1 |
| InChI | InChI=1S/C19H21F4N3O3/c1-4-24-18(26-10-14-8-15(11(2)29-14)17(27)28-3)25-9-12-5-6-13(20)7-16(12)19(21,22)23/h5-8H,4,9-10H2,1-3H3,(H2,24,25,26) |
| InChIKey | VYUJRZIXHCQIRI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|