C18H22F4N4O — CID 111586045
1-ethyl-2-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine (PubChem CID 111586045) has the molecular formula C18H22F4N4O and a molecular weight of 386.39 g/mol. Its IUPAC name is 1-ethyl-2-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine.
| Compound Name | 1-ethyl-2-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111586045 |
| Molecular Formula | C18H22F4N4O |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 1-ethyl-2-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(F)cc1C(F)(F)F)NCc1cc(C(C)C)no1 |
| InChI | InChI=1S/C18H22F4N4O/c1-4-23-17(25-10-14-8-16(11(2)3)26-27-14)24-9-12-5-6-13(19)7-15(12)18(20,21)22/h5-8,11H,4,9-10H2,1-3H3,(H2,23,24,25) |
| InChIKey | JQJUDDXNGCFLOI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|