C19H26F3IN4O2 — CID 111584685
1-ethyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-2-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111584685) has the molecular formula C19H26F3IN4O2 and a molecular weight of 526.34 g/mol. Its IUPAC name is 1-ethyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-2-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-2-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111584685 |
| Molecular Formula | C19H26F3IN4O2 |
| Molecular Weight | 526.34 g/mol |
| Exact Mass | 526.11 |
| IUPAC Name | 1-ethyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-2-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(OCC(F)(F)F)c1)NCc1cc(C(C)C)no1.I |
| InChI | InChI=1S/C19H25F3N4O2.HI/c1-4-23-18(25-11-16-9-17(13(2)3)26-28-16)24-10-14-6-5-7-15(8-14)27-12-19(20,21)22;/h5-9,13H,4,10-12H2,1-3H3,(H2,23,24,25);1H |
| InChIKey | QQSHBPPFPUCQFI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.34 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|