C19H26F2N4O2 — CID 111586469
2-[[3-(2,2-difluoroethoxy)phenyl]methyl]-1-ethyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine (PubChem CID 111586469) has the molecular formula C19H26F2N4O2 and a molecular weight of 380.44 g/mol. Its IUPAC name is 2-[[3-(2,2-difluoroethoxy)phenyl]methyl]-1-ethyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine.
| Compound Name | 2-[[3-(2,2-difluoroethoxy)phenyl]methyl]-1-ethyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111586469 |
| Molecular Formula | C19H26F2N4O2 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 2-[[3-(2,2-difluoroethoxy)phenyl]methyl]-1-ethyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(OCC(F)F)c1)NCc1cc(C(C)C)no1 |
| InChI | InChI=1S/C19H26F2N4O2/c1-4-22-19(24-11-16-9-17(13(2)3)25-27-16)23-10-14-6-5-7-15(8-14)26-12-18(20)21/h5-9,13,18H,4,10-12H2,1-3H3,(H2,22,23,24) |
| InChIKey | MUBXUEIXNCWACL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|