C20H28F3N5O2 — CID 111676380
1-ethyl-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]-2-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]guanidine (PubChem CID 111676380) has the molecular formula C20H28F3N5O2 and a molecular weight of 427.47 g/mol. Its IUPAC name is 1-ethyl-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]-2-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]-2-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111676380 |
| Molecular Formula | C20H28F3N5O2 |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | 1-ethyl-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]-2-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccnc(OCC(F)(F)F)c1)NCc1cc(C(CC)CC)no1 |
| InChI | InChI=1S/C20H28F3N5O2/c1-4-15(5-2)17-10-16(30-28-17)12-27-19(24-6-3)26-11-14-7-8-25-18(9-14)29-13-20(21,22)23/h7-10,15H,4-6,11-13H2,1-3H3,(H2,24,26,27) |
| InChIKey | WRXUWKRUJXGZLS-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|