C16H26IN3O3 — CID 111144489
methyl 2-methyl-5-[[[N-methyl-C-(3-methylpiperidin-1-yl)carbonimidoyl]amino]methyl]furan-3-carboxylate;hydroiodide (PubChem CID 111144489) has the molecular formula C16H26IN3O3 and a molecular weight of 435.31 g/mol. Its IUPAC name is methyl 2-methyl-5-[[[N-methyl-C-(3-methylpiperidin-1-yl)carbonimidoyl]amino]methyl]furan-3-carboxylate;hydroiodide.
| Compound Name | methyl 2-methyl-5-[[[N-methyl-C-(3-methylpiperidin-1-yl)carbonimidoyl]amino]methyl]furan-3-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111144489 |
| Molecular Formula | C16H26IN3O3 |
| Molecular Weight | 435.31 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | methyl 2-methyl-5-[[[N-methyl-C-(3-methylpiperidin-1-yl)carbonimidoyl]amino]methyl]furan-3-carboxylate;hydroiodide |
| SMILES | C/N=C(\NCc1cc(C(=O)OC)c(C)o1)N1CCCC(C)C1.I |
| InChI | InChI=1S/C16H25N3O3.HI/c1-11-6-5-7-19(10-11)16(17-3)18-9-13-8-14(12(2)22-13)15(20)21-4;/h8,11H,5-7,9-10H2,1-4H3,(H,17,18);1H |
| InChIKey | PESPBDWPTQOZRJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|