C18H26IN3O4 — CID 119144413
methyl 5-[[[C-(1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl)-N-methylcarbonimidoyl]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide (PubChem CID 119144413) has the molecular formula C18H26IN3O4 and a molecular weight of 475.33 g/mol. Its IUPAC name is methyl 5-[[[C-(1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl)-N-methylcarbonimidoyl]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide.
| Compound Name | methyl 5-[[[C-(1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl)-N-methylcarbonimidoyl]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 119144413 |
| Molecular Formula | C18H26IN3O4 |
| Molecular Weight | 475.33 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | methyl 5-[[[C-(1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl)-N-methylcarbonimidoyl]amino]methyl]-2-methylfuran-3-carboxylate;hydroiodide |
| SMILES | C/N=C(\NCc1cc(C(=O)OC)c(C)o1)N1CC2C3CCC(O3)C2C1.I |
| InChI | InChI=1S/C18H25N3O4.HI/c1-10-12(17(22)23-3)6-11(24-10)7-20-18(19-2)21-8-13-14(9-21)16-5-4-15(13)25-16;/h6,13-16H,4-5,7-9H2,1-3H3,(H,19,20);1H |
| InChIKey | AECBTXQYMZGLRM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|