C20H27N3O4 — CID 119144820
methyl 5-[[[C-(1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl)-N-methylcarbonimidoyl]amino]methyl]-2-methoxybenzoate (PubChem CID 119144820) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is methyl 5-[[[C-(1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl)-N-methylcarbonimidoyl]amino]methyl]-2-methoxybenzoate.
| Compound Name | methyl 5-[[[C-(1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl)-N-methylcarbonimidoyl]amino]methyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 119144820 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | methyl 5-[[[C-(1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl)-N-methylcarbonimidoyl]amino]methyl]-2-methoxybenzoate |
| SMILES | C/N=C(\NCc1ccc(OC)c(C(=O)OC)c1)N1CC2C3CCC(O3)C2C1 |
| InChI | InChI=1S/C20H27N3O4/c1-21-20(23-10-14-15(11-23)18-7-6-17(14)27-18)22-9-12-4-5-16(25-2)13(8-12)19(24)26-3/h4-5,8,14-15,17-18H,6-7,9-11H2,1-3H3,(H,21,22) |
| InChIKey | VFIYMFBUWJTGMH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|