C18H25ClIN3O2 — CID 119157307
N-[(4-chloro-2-methoxyphenyl)methyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide (PubChem CID 119157307) has the molecular formula C18H25ClIN3O2 and a molecular weight of 477.77 g/mol. Its IUPAC name is N-[(4-chloro-2-methoxyphenyl)methyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide.
| Compound Name | N-[(4-chloro-2-methoxyphenyl)methyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119157307 |
| Molecular Formula | C18H25ClIN3O2 |
| Molecular Weight | 477.77 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | N-[(4-chloro-2-methoxyphenyl)methyl]-N'-methyl-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(Cl)cc1OC)N1CC2C3CCC(O3)C2C1.I |
| InChI | InChI=1S/C18H24ClN3O2.HI/c1-20-18(21-8-11-3-4-12(19)7-17(11)23-2)22-9-13-14(10-22)16-6-5-15(13)24-16;/h3-4,7,13-16H,5-6,8-10H2,1-2H3,(H,20,21);1H |
| InChIKey | MWQUJIFGWGVQRM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.77 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|